C21H28F2N2O2 — CID 143279587
(2E,3E)-N-[(3,4-difluorophenyl)methyl]-5-(dipropylamino)-2-ethylidene-4-hydroxyhexa-3,5-dienamide (PubChem CID 143279587) has the molecular formula C21H28F2N2O2 and a molecular weight of 378.46 g/mol. Its IUPAC name is (2E,3E)-N-[(3,4-difluorophenyl)methyl]-5-(dipropylamino)-2-ethylidene-4-hydroxyhexa-3,5-dienamide.
| Compound Name | (2E,3E)-N-[(3,4-difluorophenyl)methyl]-5-(dipropylamino)-2-ethylidene-4-hydroxyhexa-3,5-dienamide |
|---|---|
| PubChem CID | 143279587 |
| Molecular Formula | C21H28F2N2O2 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (2E,3E)-N-[(3,4-difluorophenyl)methyl]-5-(dipropylamino)-2-ethylidene-4-hydroxyhexa-3,5-dienamide |
| SMILES | C=C(/C(O)=C\C(=C/C)C(=O)NCc1ccc(F)c(F)c1)N(CCC)CCC |
| InChI | InChI=1S/C21H28F2N2O2/c1-5-10-25(11-6-2)15(4)20(26)13-17(7-3)21(27)24-14-16-8-9-18(22)19(23)12-16/h7-9,12-13,26H,4-6,10-11,14H2,1-3H3,(H,24,27)/b17-7+,20-13+ |
| InChIKey | CBYQIGHHPUEQKD-BZSBEMSNSA-N |
| XLogP | 4.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|