C33H52ClN3 — CID 143279706
1-[1-[(3E,5E)-6-chloro-3-methylocta-3,5,7-trien-2-yl]piperidin-4-yl]-4-[(3Z,5E)-5-ethylidene-3,6-dimethylocta-1,3,6,7-tetraen-2-yl]piperazine;propane (PubChem CID 143279706) has the molecular formula C33H52ClN3 and a molecular weight of 526.25 g/mol. Its IUPAC name is 1-[1-[(3E,5E)-6-chloro-3-methylocta-3,5,7-trien-2-yl]piperidin-4-yl]-4-[(3Z,5E)-5-ethylidene-3,6-dimethylocta-1,3,6,7-tetraen-2-yl]piperazine;propane.
| Compound Name | 1-[1-[(3E,5E)-6-chloro-3-methylocta-3,5,7-trien-2-yl]piperidin-4-yl]-4-[(3Z,5E)-5-ethylidene-3,6-dimethylocta-1,3,6,7-tetraen-2-yl]piperazine;propane |
|---|---|
| PubChem CID | 143279706 |
| Molecular Formula | C33H52ClN3 |
| Molecular Weight | 526.25 g/mol |
| Exact Mass | 525.38 |
| IUPAC Name | 1-[1-[(3E,5E)-6-chloro-3-methylocta-3,5,7-trien-2-yl]piperidin-4-yl]-4-[(3Z,5E)-5-ethylidene-3,6-dimethylocta-1,3,6,7-tetraen-2-yl]piperazine;propane |
| SMILES | C=C=C(C)C(/C=C(/C)C(=C)N1CCN(C2CCN(C(C)/C(C)=C/C=C(/Cl)C=C)CC2)CC1)=C/C.CCC |
| InChI | InChI=1S/C30H44ClN3.C3H8/c1-9-23(4)28(10-2)22-25(6)27(8)33-18-20-34(21-19-33)30-14-16-32(17-15-30)26(7)24(5)12-13-29(31)11-3;1-3-2/h10-13,22,26,30H,1,3,8,14-21H2,2,4-7H3;3H2,1-2H3/b24-12+,25-22-,28-10+,29-13+; |
| InChIKey | BALRTBVXAIGMRK-VDVGWBLMSA-N |
| XLogP | 8.27 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.25 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|