C34H58ClN5 — CID 143279793
(1E,3E)-2-[(Z)-3-[4-[1-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]piperidin-4-yl]-3-methylpiperazin-1-yl]-2-methylprop-1-enyl]-3-N-(cyclohexylmethyl)-1-N-methylpenta-1,3-diene-1,3-diamine (PubChem CID 143279793) has the molecular formula C34H58ClN5 and a molecular weight of 572.33 g/mol. Its IUPAC name is (1E,3E)-2-[(Z)-3-[4-[1-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]piperidin-4-yl]-3-methylpiperazin-1-yl]-2-methylprop-1-enyl]-3-N-(cyclohexylmethyl)-1-N-methylpenta-1,3-diene-1,3-diamine.
| Compound Name | (1E,3E)-2-[(Z)-3-[4-[1-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]piperidin-4-yl]-3-methylpiperazin-1-yl]-2-methylprop-1-enyl]-3-N-(cyclohexylmethyl)-1-N-methylpenta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 143279793 |
| Molecular Formula | C34H58ClN5 |
| Molecular Weight | 572.33 g/mol |
| Exact Mass | 571.44 |
| IUPAC Name | (1E,3E)-2-[(Z)-3-[4-[1-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]piperidin-4-yl]-3-methylpiperazin-1-yl]-2-methylprop-1-enyl]-3-N-(cyclohexylmethyl)-1-N-methylpenta-1,3-diene-1,3-diamine |
| SMILES | C/C=C(NCC1CCCCC1)\C(/C=C(/C)CN1CCN(C2CCN(C/C(C)=C/C=C(\C)Cl)CC2)C(C)C1)=C\NC |
| InChI | InChI=1S/C34H58ClN5/c1-7-34(37-22-31-11-9-8-10-12-31)32(23-36-6)21-28(3)25-39-19-20-40(30(5)26-39)33-15-17-38(18-16-33)24-27(2)13-14-29(4)35/h7,13-14,21,23,30-31,33,36-37H,8-12,15-20,22,24-26H2,1-6H3/b27-13+,28-21-,29-14+,32-23+,34-7+ |
| InChIKey | BWUDQBRWXACKTE-LYAASHMCSA-N |
| XLogP | 6.67 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.33 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|