C29H51N5 — CID 143279897
(1E)-3-N-(cyclohexylmethyl)-2-[(Z)-3-[4-[1-[(E)-2-ethylbut-2-enyl]piperidin-4-yl]piperazin-1-yl]prop-1-enyl]buta-1,3-diene-1,3-diamine (PubChem CID 143279897) has the molecular formula C29H51N5 and a molecular weight of 469.76 g/mol. Its IUPAC name is (1E)-3-N-(cyclohexylmethyl)-2-[(Z)-3-[4-[1-[(E)-2-ethylbut-2-enyl]piperidin-4-yl]piperazin-1-yl]prop-1-enyl]buta-1,3-diene-1,3-diamine.
| Compound Name | (1E)-3-N-(cyclohexylmethyl)-2-[(Z)-3-[4-[1-[(E)-2-ethylbut-2-enyl]piperidin-4-yl]piperazin-1-yl]prop-1-enyl]buta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 143279897 |
| Molecular Formula | C29H51N5 |
| Molecular Weight | 469.76 g/mol |
| Exact Mass | 469.41 |
| IUPAC Name | (1E)-3-N-(cyclohexylmethyl)-2-[(Z)-3-[4-[1-[(E)-2-ethylbut-2-enyl]piperidin-4-yl]piperazin-1-yl]prop-1-enyl]buta-1,3-diene-1,3-diamine |
| SMILES | C=C(NCC1CCCCC1)C(/C=C\CN1CCN(C2CCN(C/C(=C/C)CC)CC2)CC1)=C/N |
| InChI | InChI=1S/C29H51N5/c1-4-26(5-2)24-33-16-13-29(14-17-33)34-20-18-32(19-21-34)15-9-12-28(22-30)25(3)31-23-27-10-7-6-8-11-27/h4,9,12,22,27,29,31H,3,5-8,10-11,13-21,23-24,30H2,1-2H3/b12-9-,26-4+,28-22+ |
| InChIKey | ZJOZKDFEHCPBPC-VVYCBUCISA-N |
| XLogP | 4.51 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|