C29H43F2N3 — CID 143279917
1-[1-[(3Z,5E)-5,7-difluoro-2-methylocta-3,5,7-trienyl]piperidin-4-yl]-4-[(3Z,5E)-3-methyl-5-prop-1-en-2-ylhepta-1,3,5-trien-2-yl]piperazine (PubChem CID 143279917) has the molecular formula C29H43F2N3 and a molecular weight of 471.68 g/mol. Its IUPAC name is 1-[1-[(3Z,5E)-5,7-difluoro-2-methylocta-3,5,7-trienyl]piperidin-4-yl]-4-[(3Z,5E)-3-methyl-5-prop-1-en-2-ylhepta-1,3,5-trien-2-yl]piperazine.
| Compound Name | 1-[1-[(3Z,5E)-5,7-difluoro-2-methylocta-3,5,7-trienyl]piperidin-4-yl]-4-[(3Z,5E)-3-methyl-5-prop-1-en-2-ylhepta-1,3,5-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 143279917 |
| Molecular Formula | C29H43F2N3 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.34 |
| IUPAC Name | 1-[1-[(3Z,5E)-5,7-difluoro-2-methylocta-3,5,7-trienyl]piperidin-4-yl]-4-[(3Z,5E)-3-methyl-5-prop-1-en-2-ylhepta-1,3,5-trien-2-yl]piperazine |
| SMILES | C=C(F)/C=C(F)\C=C/C(C)CN1CCC(N2CCN(C(=C)/C(C)=C\C(=C/C)C(=C)C)CC2)CC1 |
| InChI | InChI=1S/C29H43F2N3/c1-8-27(22(2)3)19-24(5)26(7)33-15-17-34(18-16-33)29-11-13-32(14-12-29)21-23(4)9-10-28(31)20-25(6)30/h8-10,19-20,23,29H,2,6-7,11-18,21H2,1,3-5H3/b10-9-,24-19-,27-8+,28-20+ |
| InChIKey | NCIKUHAJOJVWEO-NWUFFWBMSA-N |
| XLogP | 6.58 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|