C27H46N4 — CID 143280032
(1Z,3Z)-5-[4-[1-[(2E,4Z)-2,5-dimethylhepta-2,4,6-trienyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2,4-dimethylpenta-1,3-dien-1-amine (PubChem CID 143280032) has the molecular formula C27H46N4 and a molecular weight of 426.69 g/mol. Its IUPAC name is (1Z,3Z)-5-[4-[1-[(2E,4Z)-2,5-dimethylhepta-2,4,6-trienyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2,4-dimethylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-[4-[1-[(2E,4Z)-2,5-dimethylhepta-2,4,6-trienyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2,4-dimethylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143280032 |
| Molecular Formula | C27H46N4 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.37 |
| IUPAC Name | (1Z,3Z)-5-[4-[1-[(2E,4Z)-2,5-dimethylhepta-2,4,6-trienyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]-2,4-dimethylpenta-1,3-dien-1-amine |
| SMILES | C=C/C(C)=C\C=C(/C)CN1CCC(N2CCN(C/C(C)=C\C(C)=C/N)CC2CC)CC1 |
| InChI | InChI=1S/C27H46N4/c1-7-22(3)9-10-23(4)19-29-13-11-27(12-14-29)31-16-15-30(21-26(31)8-2)20-25(6)17-24(5)18-28/h7,9-10,17-18,26-27H,1,8,11-16,19-21,28H2,2-6H3/b22-9-,23-10+,24-18-,25-17- |
| InChIKey | IUIVBDTXZIYUQC-ILRULXIJSA-N |
| XLogP | 4.73 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|