C18H24F2N2 — CID 143280175
1-N-(2,2-difluoropropyl)-2-N-[(2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-yl]-3,4-dimethylidenecyclobutene-1,2-diamine (PubChem CID 143280175) has the molecular formula C18H24F2N2 and a molecular weight of 306.40 g/mol. Its IUPAC name is 1-N-(2,2-difluoropropyl)-2-N-[(2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-yl]-3,4-dimethylidenecyclobutene-1,2-diamine.
| Compound Name | 1-N-(2,2-difluoropropyl)-2-N-[(2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-yl]-3,4-dimethylidenecyclobutene-1,2-diamine |
|---|---|
| PubChem CID | 143280175 |
| Molecular Formula | C18H24F2N2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-N-(2,2-difluoropropyl)-2-N-[(2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-yl]-3,4-dimethylidenecyclobutene-1,2-diamine |
| SMILES | C=C1C(=C)C(NC(/C=C(/C)C(=C)C)=C/C)=C1NCC(C)(F)F |
| InChI | InChI=1S/C18H24F2N2/c1-8-15(9-12(4)11(2)3)22-17-14(6)13(5)16(17)21-10-18(7,19)20/h8-9,21-22H,2,5-6,10H2,1,3-4,7H3/b12-9-,15-8+ |
| InChIKey | MDTRZKQBVXCPNU-DUFKSJPMSA-N |
| XLogP | 4.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|