C16H26FN — CID 143280243
1-[(2Z,3Z,5Z)-2-(1-fluoroethylidene)-5-methylhepta-3,5-dienyl]-4-methylpiperidine (PubChem CID 143280243) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is 1-[(2Z,3Z,5Z)-2-(1-fluoroethylidene)-5-methylhepta-3,5-dienyl]-4-methylpiperidine.
| Compound Name | 1-[(2Z,3Z,5Z)-2-(1-fluoroethylidene)-5-methylhepta-3,5-dienyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 143280243 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-[(2Z,3Z,5Z)-2-(1-fluoroethylidene)-5-methylhepta-3,5-dienyl]-4-methylpiperidine |
| SMILES | C/C=C(C)\C=C/C(CN1CCC(C)CC1)=C(\C)F |
| InChI | InChI=1S/C16H26FN/c1-5-13(2)6-7-16(15(4)17)12-18-10-8-14(3)9-11-18/h5-7,14H,8-12H2,1-4H3/b7-6-,13-5-,16-15- |
| InChIKey | RCQJZJOKMFIUQP-LQQGWCIMSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|