C19H25F3N2 — CID 143280443
(4Z)-2-N-[(2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-yl]-3-methylidene-4-propylidene-1-N-(2,2,2-trifluoroethyl)cyclobutene-1,2-diamine (PubChem CID 143280443) has the molecular formula C19H25F3N2 and a molecular weight of 338.42 g/mol. Its IUPAC name is (4Z)-2-N-[(2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-yl]-3-methylidene-4-propylidene-1-N-(2,2,2-trifluoroethyl)cyclobutene-1,2-diamine.
| Compound Name | (4Z)-2-N-[(2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-yl]-3-methylidene-4-propylidene-1-N-(2,2,2-trifluoroethyl)cyclobutene-1,2-diamine |
|---|---|
| PubChem CID | 143280443 |
| Molecular Formula | C19H25F3N2 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (4Z)-2-N-[(2E,4Z)-5,6-dimethylhepta-2,4,6-trien-3-yl]-3-methylidene-4-propylidene-1-N-(2,2,2-trifluoroethyl)cyclobutene-1,2-diamine |
| SMILES | C=C(C)/C(C)=C\C(=C/C)NC1=C(NCC(F)(F)F)/C(=C\CC)C1=C |
| InChI | InChI=1S/C19H25F3N2/c1-7-9-16-14(6)17(18(16)23-11-19(20,21)22)24-15(8-2)10-13(5)12(3)4/h8-10,23-24H,3,6-7,11H2,1-2,4-5H3/b13-10-,15-8+,16-9- |
| InChIKey | ZONILBFGUQQDIZ-BZBMODLISA-N |
| XLogP | 5.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|