C31H51FN4 — CID 143280483
(1Z,3Z)-2-but-3-en-2-yl-5-[3-ethyl-4-[1-[(2Z,4Z)-2-ethyl-3-fluoro-5-methylhepta-2,4,6-trienyl]piperidin-4-yl]piperazin-1-yl]-4-methylpenta-1,3-dien-1-amine (PubChem CID 143280483) has the molecular formula C31H51FN4 and a molecular weight of 498.78 g/mol. Its IUPAC name is (1Z,3Z)-2-but-3-en-2-yl-5-[3-ethyl-4-[1-[(2Z,4Z)-2-ethyl-3-fluoro-5-methylhepta-2,4,6-trienyl]piperidin-4-yl]piperazin-1-yl]-4-methylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-2-but-3-en-2-yl-5-[3-ethyl-4-[1-[(2Z,4Z)-2-ethyl-3-fluoro-5-methylhepta-2,4,6-trienyl]piperidin-4-yl]piperazin-1-yl]-4-methylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143280483 |
| Molecular Formula | C31H51FN4 |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.41 |
| IUPAC Name | (1Z,3Z)-2-but-3-en-2-yl-5-[3-ethyl-4-[1-[(2Z,4Z)-2-ethyl-3-fluoro-5-methylhepta-2,4,6-trienyl]piperidin-4-yl]piperazin-1-yl]-4-methylpenta-1,3-dien-1-amine |
| SMILES | C=C/C(C)=C\C(F)=C(/CC)CN1CCC(N2CCN(C/C(C)=C\C(=C/N)C(C)C=C)CC2CC)CC1 |
| InChI | InChI=1S/C31H51FN4/c1-8-24(5)19-31(32)27(10-3)22-34-14-12-30(13-15-34)36-17-16-35(23-29(36)11-4)21-25(6)18-28(20-33)26(7)9-2/h8-9,18-20,26,29-30H,1-2,10-17,21-23,33H2,3-7H3/b24-19-,25-18-,28-20+,31-27- |
| InChIKey | SNTAEBOKOYGJDD-LEMKSXIASA-N |
| XLogP | 6.22 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|