C28H46ClN7O4S — CID 143280639
(2Z,4E)-1-[4-[4-(6-acetyl-5-amino-2-oxo-1H-pyrazin-3-yl)-2-ethylpiperazin-1-yl]piperidin-1-yl]-5-chloro-N,2-dimethylhepta-2,4,6-triene-3-sulfonamide;ethane (PubChem CID 143280639) has the molecular formula C28H46ClN7O4S and a molecular weight of 612.24 g/mol. Its IUPAC name is (2Z,4E)-1-[4-[4-(6-acetyl-5-amino-2-oxo-1H-pyrazin-3-yl)-2-ethylpiperazin-1-yl]piperidin-1-yl]-5-chloro-N,2-dimethylhepta-2,4,6-triene-3-sulfonamide;ethane.
| Compound Name | (2Z,4E)-1-[4-[4-(6-acetyl-5-amino-2-oxo-1H-pyrazin-3-yl)-2-ethylpiperazin-1-yl]piperidin-1-yl]-5-chloro-N,2-dimethylhepta-2,4,6-triene-3-sulfonamide;ethane |
|---|---|
| PubChem CID | 143280639 |
| Molecular Formula | C28H46ClN7O4S |
| Molecular Weight | 612.24 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | (2Z,4E)-1-[4-[4-(6-acetyl-5-amino-2-oxo-1H-pyrazin-3-yl)-2-ethylpiperazin-1-yl]piperidin-1-yl]-5-chloro-N,2-dimethylhepta-2,4,6-triene-3-sulfonamide;ethane |
| SMILES | C=C/C(Cl)=C\C(=C(/C)CN1CCC(N2CCN(c3nc(N)c(C(C)=O)[nH]c3=O)CC2CC)CC1)S(=O)(=O)NC.CC |
| InChI | InChI=1S/C26H40ClN7O4S.C2H6/c1-6-19(27)14-22(39(37,38)29-5)17(3)15-32-10-8-21(9-11-32)34-13-12-33(16-20(34)7-2)25-26(36)30-23(18(4)35)24(28)31-25;1-2/h6,14,20-21,29H,1,7-13,15-16H2,2-5H3,(H2,28,31)(H,30,36);1-2H3/b19-14+,22-17-; |
| InChIKey | NTVVWJMHAADXCB-LTUIJNFGSA-N |
| XLogP | 3.08 |
| TPSA | 144.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|