About N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine
N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine (PubChem CID 143280665) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine |
| PubChem CID | 143280665 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine |
| SMILES | C=C(NCCN)/C(C)=C/N=C(\C)CC |
| InChI | InChI=1S/C11H21N3/c1-5-10(3)14-8-9(2)11(4)13-7-6-12/h8,13H,4-7,12H2,1-3H3/b9-8+,14-10+ |
| InChIKey | KIHXHHQBRFUCMA-ANVLWLQNSA-N |
| XLogP | 1.82 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine?
The IUPAC name of N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine (CID 143280665) is N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine.
What is the SMILES notation for N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine?
The canonical SMILES for N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine is C=C(NCCN)/C(C)=C/N=C(\C)CC.
What is the InChIKey of N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine?
The InChIKey is KIHXHHQBRFUCMA-ANVLWLQNSA-N. The full InChI is InChI=1S/C11H21N3/c1-5-10(3)14-8-9(2)11(4)13-7-6-12/h8,13H,4-7,12H2,1-3H3/b9-8+,14-10+.
What are the key properties of N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine?
N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine has a molecular weight of 195.31 g/mol, XLogP of 1.82, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3E)-4-(butan-2-ylideneamino)-3-methylbuta-1,3-dien-2-yl]ethane-1,2-diamine is sourced from PubChem (CID 143280665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).