C20H31F4N — CID 143281158
ethane;5-[(2Z,4E)-4-fluorohepta-2,4-dienyl]-7-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridine (PubChem CID 143281158) has the molecular formula C20H31F4N and a molecular weight of 361.47 g/mol. Its IUPAC name is ethane;5-[(2Z,4E)-4-fluorohepta-2,4-dienyl]-7-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridine.
| Compound Name | ethane;5-[(2Z,4E)-4-fluorohepta-2,4-dienyl]-7-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridine |
|---|---|
| PubChem CID | 143281158 |
| Molecular Formula | C20H31F4N |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | ethane;5-[(2Z,4E)-4-fluorohepta-2,4-dienyl]-7-methyl-2-(2,2,2-trifluoroethyl)-1,3,4,6,7,7a-hexahydrocyclopenta[c]pyridine |
| SMILES | CC.CC/C=C(F)\C=C/CC1=C2CCN(CC(F)(F)F)CC2C(C)C1 |
| InChI | InChI=1S/C18H25F4N.C2H6/c1-3-5-15(19)7-4-6-14-10-13(2)17-11-23(9-8-16(14)17)12-18(20,21)22;1-2/h4-5,7,13,17H,3,6,8-12H2,1-2H3;1-2H3/b7-4-,15-5+; |
| InChIKey | YUQSSBYDTQXHGS-OFYIMEIFSA-N |
| XLogP | 6.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|