C21H31Cl2N3OS — CID 143281717
chloromethane;2-(2-chlorophenyl)-4-methyl-1,3-thiazole;1-[3-(diethylamino)pyrrolidin-1-yl]ethanone (PubChem CID 143281717) has the molecular formula C21H31Cl2N3OS and a molecular weight of 444.47 g/mol. Its IUPAC name is chloromethane;2-(2-chlorophenyl)-4-methyl-1,3-thiazole;1-[3-(diethylamino)pyrrolidin-1-yl]ethanone.
| Compound Name | chloromethane;2-(2-chlorophenyl)-4-methyl-1,3-thiazole;1-[3-(diethylamino)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 143281717 |
| Molecular Formula | C21H31Cl2N3OS |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | chloromethane;2-(2-chlorophenyl)-4-methyl-1,3-thiazole;1-[3-(diethylamino)pyrrolidin-1-yl]ethanone |
| SMILES | CCN(CC)C1CCN(C(C)=O)C1.CCl.Cc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C10H8ClNS.C10H20N2O.CH3Cl/c1-7-6-13-10(12-7)8-4-2-3-5-9(8)11;1-4-11(5-2)10-6-7-12(8-10)9(3)13;1-2/h2-6H,1H3;10H,4-8H2,1-3H3;1H3 |
| InChIKey | CXKARSVCHWNGTQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|