About (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine
(2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine (PubChem CID 143282277) has the molecular formula C9H14F3NO
and a molecular weight of 209.21 g/mol. Its IUPAC name is (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine.
Molecular Properties
| Compound Name | (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine |
| PubChem CID | 143282277 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine |
| SMILES | C/C=C\C(C/C=C(\C)N)OC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO/c1-3-4-8(6-5-7(2)13)14-9(10,11)12/h3-5,8H,6,13H2,1-2H3/b4-3-,7-5+ |
| InChIKey | NKEKAYLQIUATOI-QVXLNCAUSA-N |
| XLogP | 2.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine?
The IUPAC name of (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine (CID 143282277) is (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine.
What is the SMILES notation for (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine?
The canonical SMILES for (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine is C/C=C\C(C/C=C(\C)N)OC(F)(F)F.
What is the InChIKey of (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine?
The InChIKey is NKEKAYLQIUATOI-QVXLNCAUSA-N. The full InChI is InChI=1S/C9H14F3NO/c1-3-4-8(6-5-7(2)13)14-9(10,11)12/h3-5,8H,6,13H2,1-2H3/b4-3-,7-5+.
What are the key properties of (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine?
(2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine has a molecular weight of 209.21 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6Z)-5-(trifluoromethoxy)octa-2,6-dien-2-amine is sourced from PubChem (CID 143282277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).