About (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine
(2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine (PubChem CID 143282299) has the molecular formula C8H14FNO
and a molecular weight of 159.20 g/mol. Its IUPAC name is (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine.
Molecular Properties
| Compound Name | (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine |
| PubChem CID | 143282299 |
| Molecular Formula | C8H14FNO |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine |
| SMILES | CC/C=C(N)\C=C/COCF |
| InChI | InChI=1S/C8H14FNO/c1-2-4-8(10)5-3-6-11-7-9/h3-5H,2,6-7,10H2,1H3/b5-3-,8-4+ |
| InChIKey | KQIZHVPVKZOMEG-VOGDQUTBSA-N |
| XLogP | 1.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine?
The IUPAC name of (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine (CID 143282299) is (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine.
What is the SMILES notation for (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine?
The canonical SMILES for (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine is CC/C=C(N)\C=C/COCF.
What is the InChIKey of (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine?
The InChIKey is KQIZHVPVKZOMEG-VOGDQUTBSA-N. The full InChI is InChI=1S/C8H14FNO/c1-2-4-8(10)5-3-6-11-7-9/h3-5H,2,6-7,10H2,1H3/b5-3-,8-4+.
What are the key properties of (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine?
(2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine has a molecular weight of 159.20 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-1-(fluoromethoxy)hepta-2,4-dien-4-amine is sourced from PubChem (CID 143282299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).