C4H8N2O3 — CID 143282814
(5S)-3-amino-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 143282814) has the molecular formula C4H8N2O3 and a molecular weight of 132.12 g/mol. Its IUPAC name is (5S)-3-amino-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-amino-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143282814 |
| Molecular Formula | C4H8N2O3 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | (5S)-3-amino-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | NN1C[C@@H](CO)OC1=O |
| InChI | InChI=1S/C4H8N2O3/c5-6-1-3(2-7)9-4(6)8/h3,7H,1-2,5H2/t3-/m0/s1 |
| InChIKey | DFKKPMYTKLESOV-VKHMYHEASA-N |
| XLogP | -1.33 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|