About ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene
ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene (PubChem CID 143283081) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene |
| PubChem CID | 143283081 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene |
| SMILES | CC.CC.COCCCCCC1=CC=C(C)CC1 |
| InChI | InChI=1S/C13H22O.2C2H6/c1-12-7-9-13(10-8-12)6-4-3-5-11-14-2;2*1-2/h7,9H,3-6,8,10-11H2,1-2H3;2*1-2H3 |
| InChIKey | KKBMXSUGXROCKY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene?
The IUPAC name of ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene (CID 143283081) is ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene.
What is the SMILES notation for ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene?
The canonical SMILES for ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene is CC.CC.COCCCCCC1=CC=C(C)CC1.
What is the InChIKey of ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene?
The InChIKey is KKBMXSUGXROCKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O.2C2H6/c1-12-7-9-13(10-8-12)6-4-3-5-11-14-2;2*1-2/h7,9H,3-6,8,10-11H2,1-2H3;2*1-2H3.
What are the key properties of ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene?
ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene has a molecular weight of 254.46 g/mol, XLogP of 5.91, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(5-methoxypentyl)-4-methylcyclohexa-1,3-diene is sourced from PubChem (CID 143283081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).