C13H20O — CID 143283144
2-(3-methoxypropyl)-2,3,4,5-tetrahydro-1H-indene (PubChem CID 143283144) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-2,3,4,5-tetrahydro-1H-indene.
| Compound Name | 2-(3-methoxypropyl)-2,3,4,5-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 143283144 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 2-(3-methoxypropyl)-2,3,4,5-tetrahydro-1H-indene |
| SMILES | COCCCC1CC2=C(CCC=C2)C1 |
| InChI | InChI=1S/C13H20O/c1-14-8-4-5-11-9-12-6-2-3-7-13(12)10-11/h2,6,11H,3-5,7-10H2,1H3 |
| InChIKey | KYFABEQNLMLNFT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|