C15H24O — CID 143283296
2-(5-methoxypentyl)-1,3,5-trimethylbenzene (PubChem CID 143283296) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-(5-methoxypentyl)-1,3,5-trimethylbenzene.
| Compound Name | 2-(5-methoxypentyl)-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 143283296 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-(5-methoxypentyl)-1,3,5-trimethylbenzene |
| SMILES | COCCCCCc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H24O/c1-12-10-13(2)15(14(3)11-12)8-6-5-7-9-16-4/h10-11H,5-9H2,1-4H3 |
| InChIKey | KWCSIHAGRIQFNO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|