About methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate
methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate (PubChem CID 14328420) has the molecular formula C18H19F3O4S
and a molecular weight of 388.41 g/mol. Its IUPAC name is methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate |
| PubChem CID | 14328420 |
| Molecular Formula | C18H19F3O4S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(C)C(=O)CC(=O)CC1CCSc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3O4S/c1-17(16(24)25-2)12(9-13(22)10-15(17)23)7-8-26-14-5-3-11(4-6-14)18(19,20)21/h3-6,12H,7-10H2,1-2H3 |
| InChIKey | HXOOHGAEWNXTAJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate?
The IUPAC name of methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate (CID 14328420) is methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate is COC(=O)C1(C)C(=O)CC(=O)CC1CCSc1ccc(C(F)(F)F)cc1.
What is the InChIKey of methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate?
The InChIKey is HXOOHGAEWNXTAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F3O4S/c1-17(16(24)25-2)12(9-13(22)10-15(17)23)7-8-26-14-5-3-11(4-6-14)18(19,20)21/h3-6,12H,7-10H2,1-2H3.
What are the key properties of methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate?
methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate has a molecular weight of 388.41 g/mol, XLogP of 3.92, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-methyl-2,4-dioxo-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohexane-1-carboxylate is sourced from PubChem (CID 14328420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).