C13H22N2OS — CID 143284305
ethane;2-methyl-1-[6-(2-sulfanylethylamino)-3-pyridinyl]propan-1-one (PubChem CID 143284305) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is ethane;2-methyl-1-[6-(2-sulfanylethylamino)-3-pyridinyl]propan-1-one.
| Compound Name | ethane;2-methyl-1-[6-(2-sulfanylethylamino)-3-pyridinyl]propan-1-one |
|---|---|
| PubChem CID | 143284305 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | ethane;2-methyl-1-[6-(2-sulfanylethylamino)-3-pyridinyl]propan-1-one |
| SMILES | CC.CC(C)C(=O)c1ccc(NCCS)nc1 |
| InChI | InChI=1S/C11H16N2OS.C2H6/c1-8(2)11(14)9-3-4-10(13-7-9)12-5-6-15;1-2/h3-4,7-8,15H,5-6H2,1-2H3,(H,12,13);1-2H3 |
| InChIKey | OIKXMGYSTBATNE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|