C10H17NO — CID 143284640
(2Z)-2-(ethylamino)octa-2,5,7-trien-3-ol (PubChem CID 143284640) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2Z)-2-(ethylamino)octa-2,5,7-trien-3-ol.
| Compound Name | (2Z)-2-(ethylamino)octa-2,5,7-trien-3-ol |
|---|---|
| PubChem CID | 143284640 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2Z)-2-(ethylamino)octa-2,5,7-trien-3-ol |
| SMILES | C=CC=CC/C(O)=C(\C)NCC |
| InChI | InChI=1S/C10H17NO/c1-4-6-7-8-10(12)9(3)11-5-2/h4,6-7,11-12H,1,5,8H2,2-3H3/b7-6?,10-9- |
| InChIKey | CIKPGBJRDZVTSX-CZTAHCJSSA-N |
| XLogP | 2.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|