C21H25NO2 — CID 143284760
1-(4-hydroxyphenyl)-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone;prop-1-ene (PubChem CID 143284760) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone;prop-1-ene.
| Compound Name | 1-(4-hydroxyphenyl)-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone;prop-1-ene |
|---|---|
| PubChem CID | 143284760 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-(4-hydroxyphenyl)-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone;prop-1-ene |
| SMILES | C=CC.CC1CCc2ccccc2N1CC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H19NO2.C3H6/c1-13-6-7-14-4-2-3-5-17(14)19(13)12-18(21)15-8-10-16(20)11-9-15;1-3-2/h2-5,8-11,13,20H,6-7,12H2,1H3;3H,1H2,2H3 |
| InChIKey | ALDFRHOUQQODED-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|