C18H30O — CID 143285210
ethane;2-[(2E)-penta-2,4-dien-2-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)oxirane (PubChem CID 143285210) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is ethane;2-[(2E)-penta-2,4-dien-2-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)oxirane.
| Compound Name | ethane;2-[(2E)-penta-2,4-dien-2-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)oxirane |
|---|---|
| PubChem CID | 143285210 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | ethane;2-[(2E)-penta-2,4-dien-2-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)oxirane |
| SMILES | C=C/C=C(\C)C1OC1C1=C(C)CCCC1(C)C.CC |
| InChI | InChI=1S/C16H24O.C2H6/c1-6-8-12(3)14-15(17-14)13-11(2)9-7-10-16(13,4)5;1-2/h6,8,14-15H,1,7,9-10H2,2-5H3;1-2H3/b12-8+; |
| InChIKey | NGJQTOFPVHEPEC-MXZHIVQLSA-N |
| XLogP | 5.44 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|