About 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane
7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane (PubChem CID 143285239) has the molecular formula C24H39N
and a molecular weight of 341.58 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane.
Molecular Properties
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane |
| PubChem CID | 143285239 |
| Molecular Formula | C24H39N |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane |
| SMILES | C=C/C=C\c1c(C)c(C)c2cccnc2c1C(C)C.CC.CC.CC |
| InChI | InChI=1S/C18H21N.3C2H6/c1-6-7-9-15-13(4)14(5)16-10-8-11-19-18(16)17(15)12(2)3;3*1-2/h6-12H,1H2,2-5H3;3*1-2H3/b9-7-;;; |
| InChIKey | UTORTVHEGXHHIC-AXXLBGQXSA-N |
| XLogP | 8.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane?
The IUPAC name of 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane (CID 143285239) is 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane.
What is the SMILES notation for 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane?
The canonical SMILES for 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane is C=C/C=C\c1c(C)c(C)c2cccnc2c1C(C)C.CC.CC.CC.
What is the InChIKey of 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane?
The InChIKey is UTORTVHEGXHHIC-AXXLBGQXSA-N. The full InChI is InChI=1S/C18H21N.3C2H6/c1-6-7-9-15-13(4)14(5)16-10-8-11-19-18(16)17(15)12(2)3;3*1-2/h6-12H,1H2,2-5H3;3*1-2H3/b9-7-;;;.
What are the key properties of 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane?
7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane has a molecular weight of 341.58 g/mol, XLogP of 8.25, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(1Z)-buta-1,3-dienyl]-5,6-dimethyl-8-propan-2-ylquinoline;ethane is sourced from PubChem (CID 143285239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).