C16H22N4S — CID 143285327
N'-(1,2-benzothiazol-3-yl)-N-[3-[(Z)-prop-1-enyl]iminopropyl]propane-1,3-diamine (PubChem CID 143285327) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is N'-(1,2-benzothiazol-3-yl)-N-[3-[(Z)-prop-1-enyl]iminopropyl]propane-1,3-diamine.
| Compound Name | N'-(1,2-benzothiazol-3-yl)-N-[3-[(Z)-prop-1-enyl]iminopropyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143285327 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N'-(1,2-benzothiazol-3-yl)-N-[3-[(Z)-prop-1-enyl]iminopropyl]propane-1,3-diamine |
| SMILES | C/C=C\N=C\CCNCCCNc1nsc2ccccc12 |
| InChI | InChI=1S/C16H22N4S/c1-2-9-17-10-5-11-18-12-6-13-19-16-14-7-3-4-8-15(14)21-20-16/h2-4,7-10,18H,5-6,11-13H2,1H3,(H,19,20)/b9-2-,17-10+ |
| InChIKey | BPMMXGYMOQUFNJ-OOAMUOKWSA-N |
| XLogP | 3.68 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|