C30H36Cl2N2O5S — CID 143285454
[1-[[(Z)-C-but-3-en-2-yl-N-[(Z)-but-2-enyl]sulfonylcarbonimidoyl]-methylamino]-3-[3-methyl-2-[(Z)-prop-1-enyl]phenoxy]propan-2-yl] 2,4-dichlorobenzoate (PubChem CID 143285454) has the molecular formula C30H36Cl2N2O5S and a molecular weight of 607.60 g/mol. Its IUPAC name is [1-[[(Z)-C-but-3-en-2-yl-N-[(Z)-but-2-enyl]sulfonylcarbonimidoyl]-methylamino]-3-[3-methyl-2-[(Z)-prop-1-enyl]phenoxy]propan-2-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-[[(Z)-C-but-3-en-2-yl-N-[(Z)-but-2-enyl]sulfonylcarbonimidoyl]-methylamino]-3-[3-methyl-2-[(Z)-prop-1-enyl]phenoxy]propan-2-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 143285454 |
| Molecular Formula | C30H36Cl2N2O5S |
| Molecular Weight | 607.60 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | [1-[[(Z)-C-but-3-en-2-yl-N-[(Z)-but-2-enyl]sulfonylcarbonimidoyl]-methylamino]-3-[3-methyl-2-[(Z)-prop-1-enyl]phenoxy]propan-2-yl] 2,4-dichlorobenzoate |
| SMILES | C=CC(C)/C(=N/S(=O)(=O)C/C=C\C)N(C)CC(COc1cccc(C)c1/C=C\C)OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H36Cl2N2O5S/c1-7-10-17-40(36,37)33-29(21(4)9-3)34(6)19-24(39-30(35)26-16-15-23(31)18-27(26)32)20-38-28-14-11-13-22(5)25(28)12-8-2/h7-16,18,21,24H,3,17,19-20H2,1-2,4-6H3/b10-7-,12-8-,33-29- |
| InChIKey | URYADEZEGWDXQD-MGYLKCHZSA-N |
| XLogP | 7.00 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.60 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|