C17H17N3O6S — CID 143285514
2-[[5-ethenyl-1,1-dioxo-4-[(Z)-prop-1-enyl]-1,2-thiazol-3-ylidene]amino]ethyl 3-nitrobenzoate (PubChem CID 143285514) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-[[5-ethenyl-1,1-dioxo-4-[(Z)-prop-1-enyl]-1,2-thiazol-3-ylidene]amino]ethyl 3-nitrobenzoate.
| Compound Name | 2-[[5-ethenyl-1,1-dioxo-4-[(Z)-prop-1-enyl]-1,2-thiazol-3-ylidene]amino]ethyl 3-nitrobenzoate |
|---|---|
| PubChem CID | 143285514 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-[[5-ethenyl-1,1-dioxo-4-[(Z)-prop-1-enyl]-1,2-thiazol-3-ylidene]amino]ethyl 3-nitrobenzoate |
| SMILES | C=CC1=C(/C=C\C)/C(=N/CCOC(=O)c2cccc([N+](=O)[O-])c2)NS1(=O)=O |
| InChI | InChI=1S/C17H17N3O6S/c1-3-6-14-15(4-2)27(24,25)19-16(14)18-9-10-26-17(21)12-7-5-8-13(11-12)20(22)23/h3-8,11H,2,9-10H2,1H3,(H,18,19)/b6-3- |
| InChIKey | ONNNAWHQYUSYSO-UTCJRWHESA-N |
| XLogP | 2.10 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|