C14H19N3 — CID 143285753
5-methyl-N-[(3Z,5Z)-3-(methylideneamino)hepta-3,5-dienyl]pyridin-2-amine (PubChem CID 143285753) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 5-methyl-N-[(3Z,5Z)-3-(methylideneamino)hepta-3,5-dienyl]pyridin-2-amine.
| Compound Name | 5-methyl-N-[(3Z,5Z)-3-(methylideneamino)hepta-3,5-dienyl]pyridin-2-amine |
|---|---|
| PubChem CID | 143285753 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 5-methyl-N-[(3Z,5Z)-3-(methylideneamino)hepta-3,5-dienyl]pyridin-2-amine |
| SMILES | C=N/C(=C\C=C/C)CCNc1ccc(C)cn1 |
| InChI | InChI=1S/C14H19N3/c1-4-5-6-13(15-3)9-10-16-14-8-7-12(2)11-17-14/h4-8,11H,3,9-10H2,1-2H3,(H,16,17)/b5-4-,13-6- |
| InChIKey | TVRJBIULUVGNGP-YIDBNINZSA-N |
| XLogP | 3.35 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|