About 5-methylpyridin-2-amine;styrene
5-methylpyridin-2-amine;styrene (PubChem CID 143285861) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-methylpyridin-2-amine;styrene.
Molecular Properties
| Compound Name | 5-methylpyridin-2-amine;styrene |
| PubChem CID | 143285861 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5-methylpyridin-2-amine;styrene |
| SMILES | C=Cc1ccccc1.Cc1ccc(N)nc1 |
| InChI | InChI=1S/C8H8.C6H8N2/c1-2-8-6-4-3-5-7-8;1-5-2-3-6(7)8-4-5/h2-7H,1H2;2-4H,1H3,(H2,7,8) |
| InChIKey | JOZRSOLYGFXESL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylpyridin-2-amine;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyridin-2-amine;styrene?
The IUPAC name of 5-methylpyridin-2-amine;styrene (CID 143285861) is 5-methylpyridin-2-amine;styrene.
What is the SMILES notation for 5-methylpyridin-2-amine;styrene?
The canonical SMILES for 5-methylpyridin-2-amine;styrene is C=Cc1ccccc1.Cc1ccc(N)nc1.
What is the InChIKey of 5-methylpyridin-2-amine;styrene?
The InChIKey is JOZRSOLYGFXESL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C6H8N2/c1-2-8-6-4-3-5-7-8;1-5-2-3-6(7)8-4-5/h2-7H,1H2;2-4H,1H3,(H2,7,8).
What are the key properties of 5-methylpyridin-2-amine;styrene?
5-methylpyridin-2-amine;styrene has a molecular weight of 212.30 g/mol, XLogP of 3.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyridin-2-amine;styrene is sourced from PubChem (CID 143285861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).