C23H27N5O3S — CID 143286227
N-[amino-(2-amino-5-formylthiophen-3-yl)methylidene]-4-methoxybenzamide;1-(2-ethylphenyl)-2-methylhydrazine (PubChem CID 143286227) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is N-[amino-(2-amino-5-formylthiophen-3-yl)methylidene]-4-methoxybenzamide;1-(2-ethylphenyl)-2-methylhydrazine.
| Compound Name | N-[amino-(2-amino-5-formylthiophen-3-yl)methylidene]-4-methoxybenzamide;1-(2-ethylphenyl)-2-methylhydrazine |
|---|---|
| PubChem CID | 143286227 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[amino-(2-amino-5-formylthiophen-3-yl)methylidene]-4-methoxybenzamide;1-(2-ethylphenyl)-2-methylhydrazine |
| SMILES | CCc1ccccc1NNC.COc1ccc(C(=O)/N=C(\N)c2cc(C=O)sc2N)cc1 |
| InChI | InChI=1S/C14H13N3O3S.C9H14N2/c1-20-9-4-2-8(3-5-9)14(19)17-12(15)11-6-10(7-18)21-13(11)16;1-3-8-6-4-5-7-9(8)11-10-2/h2-7H,16H2,1H3,(H2,15,17,19);4-7,10-11H,3H2,1-2H3 |
| InChIKey | QPSXLPVANLVIEY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|