C9H12F2O2 — CID 143286467
(3Z)-2-ethoxy-3,4-difluoro-5-methoxyhexa-1,3,5-triene (PubChem CID 143286467) has the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. Its IUPAC name is (3Z)-2-ethoxy-3,4-difluoro-5-methoxyhexa-1,3,5-triene.
| Compound Name | (3Z)-2-ethoxy-3,4-difluoro-5-methoxyhexa-1,3,5-triene |
|---|---|
| PubChem CID | 143286467 |
| Molecular Formula | C9H12F2O2 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (3Z)-2-ethoxy-3,4-difluoro-5-methoxyhexa-1,3,5-triene |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)OCC |
| InChI | InChI=1S/C9H12F2O2/c1-5-13-7(3)9(11)8(10)6(2)12-4/h2-3,5H2,1,4H3/b9-8- |
| InChIKey | GKEYIRIURDASBU-HJWRWDBZSA-N |
| XLogP | 2.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|