C31H28F6N2O2S2 — CID 143286617
4-[4-[2-[5-[4-(dimethylamino)phenyl]-2-methoxythiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxythiophen-2-yl]-N,N-dimethylaniline (PubChem CID 143286617) has the molecular formula C31H28F6N2O2S2 and a molecular weight of 638.70 g/mol. Its IUPAC name is 4-[4-[2-[5-[4-(dimethylamino)phenyl]-2-methoxythiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxythiophen-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-[2-[5-[4-(dimethylamino)phenyl]-2-methoxythiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxythiophen-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 143286617 |
| Molecular Formula | C31H28F6N2O2S2 |
| Molecular Weight | 638.70 g/mol |
| Exact Mass | 638.15 |
| IUPAC Name | 4-[4-[2-[5-[4-(dimethylamino)phenyl]-2-methoxythiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methoxythiophen-2-yl]-N,N-dimethylaniline |
| SMILES | COc1sc(-c2ccc(N(C)C)cc2)cc1C1=C(c2cc(-c3ccc(N(C)C)cc3)sc2OC)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C31H28F6N2O2S2/c1-38(2)19-11-7-17(8-12-19)23-15-21(27(40-5)42-23)25-26(30(34,35)31(36,37)29(25,32)33)22-16-24(43-28(22)41-6)18-9-13-20(14-10-18)39(3)4/h7-16H,1-6H3 |
| InChIKey | DUTDEHADRJUTBP-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.70 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|