C19H32O2 — CID 143286928
1-[(3S)-7-hydroxy-7-methyloct-1-en-3-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 143286928) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 1-[(3S)-7-hydroxy-7-methyloct-1-en-3-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | 1-[(3S)-7-hydroxy-7-methyloct-1-en-3-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 143286928 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1-[(3S)-7-hydroxy-7-methyloct-1-en-3-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C=C[C@H](CCCC(C)(C)O)C1CCC2C(=O)CCCC21C |
| InChI | InChI=1S/C19H32O2/c1-5-14(8-6-12-18(2,3)21)15-10-11-16-17(20)9-7-13-19(15,16)4/h5,14-16,21H,1,6-13H2,2-4H3/t14-,15?,16?,19?/m1/s1 |
| InChIKey | RMNSCOGOGPUHQN-XYLATYTLSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|