C28H44O2S — CID 143286953
3-[[(4E)-4-[(2Z)-2-[(3R,4E)-4-(2-hydroxyethylidene)-3-methylcyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]methylsulfanylmethyl]pentan-3-ol (PubChem CID 143286953) has the molecular formula C28H44O2S and a molecular weight of 444.73 g/mol. Its IUPAC name is 3-[[(4E)-4-[(2Z)-2-[(3R,4E)-4-(2-hydroxyethylidene)-3-methylcyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]methylsulfanylmethyl]pentan-3-ol.
| Compound Name | 3-[[(4E)-4-[(2Z)-2-[(3R,4E)-4-(2-hydroxyethylidene)-3-methylcyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]methylsulfanylmethyl]pentan-3-ol |
|---|---|
| PubChem CID | 143286953 |
| Molecular Formula | C28H44O2S |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 3-[[(4E)-4-[(2Z)-2-[(3R,4E)-4-(2-hydroxyethylidene)-3-methylcyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]methylsulfanylmethyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CSCC1=CCC2/C(=C/C=C3/CC/C(=C\CO)[C@H](C)C3)CCCC12C |
| InChI | InChI=1S/C28H44O2S/c1-5-28(30,6-2)20-31-19-25-13-14-26-24(8-7-16-27(25,26)4)12-10-22-9-11-23(15-17-29)21(3)18-22/h10,12-13,15,21,26,29-30H,5-9,11,14,16-20H2,1-4H3/b22-10-,23-15+,24-12+/t21-,26?,27?/m1/s1 |
| InChIKey | YMPVXAYVYPDGKA-KXYLHTILSA-N |
| XLogP | 7.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|