C32H58O4S — CID 143286968
cis-(1R,2S,5Z)-5-[(2E)-2-[1-[(1R)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexan-1-ol;ethane (PubChem CID 143286968) has the molecular formula C32H58O4S and a molecular weight of 538.88 g/mol. Its IUPAC name is cis-(1R,2S,5Z)-5-[(2E)-2-[1-[(1R)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexan-1-ol;ethane.
| Compound Name | cis-(1R,2S,5Z)-5-[(2E)-2-[1-[(1R)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexan-1-ol;ethane |
|---|---|
| PubChem CID | 143286968 |
| Molecular Formula | C32H58O4S |
| Molecular Weight | 538.88 g/mol |
| Exact Mass | 538.41 |
| IUPAC Name | cis-(1R,2S,5Z)-5-[(2E)-2-[1-[(1R)-1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexan-1-ol;ethane |
| SMILES | CC.CC.CCC(O)(CC)CS[C@H](C)C1=CCC2/C(=C/C=C3/CC[C@H](OCCO)[C@H](O)C3)CCCC12C |
| InChI | InChI=1S/C28H46O4S.2C2H6/c1-5-28(31,6-2)19-33-20(3)23-12-13-24-22(8-7-15-27(23,24)4)11-9-21-10-14-26(25(30)18-21)32-17-16-29;2*1-2/h9,11-12,20,24-26,29-31H,5-8,10,13-19H2,1-4H3;2*1-2H3/b21-9-,22-11+;;/t20-,24?,25-,26+,27?;;/m1../s1 |
| InChIKey | OJUIAPWVRQUXQF-DQYCSPBCSA-N |
| XLogP | 7.62 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.88 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|