C33H60O5S — CID 143286970
ethane-1,2-diol;(1S,3Z)-3-[(2E)-2-[1-[(2-ethyl-2-hydroxybutyl)sulfanylmethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;3-methylpentan-3-ol (PubChem CID 143286970) has the molecular formula C33H60O5S and a molecular weight of 568.91 g/mol. Its IUPAC name is ethane-1,2-diol;(1S,3Z)-3-[(2E)-2-[1-[(2-ethyl-2-hydroxybutyl)sulfanylmethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;3-methylpentan-3-ol.
| Compound Name | ethane-1,2-diol;(1S,3Z)-3-[(2E)-2-[1-[(2-ethyl-2-hydroxybutyl)sulfanylmethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;3-methylpentan-3-ol |
|---|---|
| PubChem CID | 143286970 |
| Molecular Formula | C33H60O5S |
| Molecular Weight | 568.91 g/mol |
| Exact Mass | 568.42 |
| IUPAC Name | ethane-1,2-diol;(1S,3Z)-3-[(2E)-2-[1-[(2-ethyl-2-hydroxybutyl)sulfanylmethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexan-1-ol;3-methylpentan-3-ol |
| SMILES | CCC(C)(O)CC.CCC(O)(CC)CSCC1=CCC2/C(=C/C=C3/CCC[C@H](O)C3)CCCC12C.OCCO |
| InChI | InChI=1S/C25H40O2S.C6H14O.C2H6O2/c1-4-25(27,5-2)18-28-17-21-13-14-23-20(9-7-15-24(21,23)3)12-11-19-8-6-10-22(26)16-19;1-4-6(3,7)5-2;3-1-2-4/h11-13,22-23,26-27H,4-10,14-18H2,1-3H3;7H,4-5H2,1-3H3;3-4H,1-2H2/b19-11-,20-12+;;/t22-,23?,24?;;/m0../s1 |
| InChIKey | LTKIMDBDBURCKD-NUWXXPILSA-N |
| XLogP | 6.72 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.91 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|