C29H52O4S — CID 143286975
cis-(1S,2R,4Z)-4-[(2E)-2-[1-[1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,2-diol;ethane;methanol (PubChem CID 143286975) has the molecular formula C29H52O4S and a molecular weight of 496.80 g/mol. Its IUPAC name is cis-(1S,2R,4Z)-4-[(2E)-2-[1-[1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,2-diol;ethane;methanol.
| Compound Name | cis-(1S,2R,4Z)-4-[(2E)-2-[1-[1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,2-diol;ethane;methanol |
|---|---|
| PubChem CID | 143286975 |
| Molecular Formula | C29H52O4S |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | cis-(1S,2R,4Z)-4-[(2E)-2-[1-[1-(2-ethyl-2-hydroxybutyl)sulfanylethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]cyclohexane-1,2-diol;ethane;methanol |
| SMILES | CC.CCC(O)(CC)CSC(C)C1=CCC2/C(=C/C=C3/CC[C@H](O)[C@H](O)C3)CCCC12C.CO |
| InChI | InChI=1S/C26H42O3S.C2H6.CH4O/c1-5-26(29,6-2)17-30-18(3)21-12-13-22-20(8-7-15-25(21,22)4)11-9-19-10-14-23(27)24(28)16-19;2*1-2/h9,11-12,18,22-24,27-29H,5-8,10,13-17H2,1-4H3;1-2H3;2H,1H3/b19-9-,20-11+;;/t18?,22?,23-,24+,25?;;/m0../s1 |
| InChIKey | MCWQIGQYLTZNQB-OMZGKPKVSA-N |
| XLogP | 6.19 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|