C31H54O4S — CID 143286982
butane;cis-(1R,2S,5Z)-5-[(2E)-2-[1-[(2-ethyl-2-hydroxybutyl)sulfanylmethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexan-1-ol (PubChem CID 143286982) has the molecular formula C31H54O4S and a molecular weight of 522.84 g/mol. Its IUPAC name is butane;cis-(1R,2S,5Z)-5-[(2E)-2-[1-[(2-ethyl-2-hydroxybutyl)sulfanylmethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexan-1-ol.
| Compound Name | butane;cis-(1R,2S,5Z)-5-[(2E)-2-[1-[(2-ethyl-2-hydroxybutyl)sulfanylmethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 143286982 |
| Molecular Formula | C31H54O4S |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | butane;cis-(1R,2S,5Z)-5-[(2E)-2-[1-[(2-ethyl-2-hydroxybutyl)sulfanylmethyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethoxy)cyclohexan-1-ol |
| SMILES | CCC(O)(CC)CSCC1=CCC2/C(=C/C=C3/CC[C@H](OCCO)[C@H](O)C3)CCCC12C.CCCC |
| InChI | InChI=1S/C27H44O4S.C4H10/c1-4-27(30,5-2)19-32-18-22-11-12-23-21(7-6-14-26(22,23)3)10-8-20-9-13-25(24(29)17-20)31-16-15-28;1-3-4-2/h8,10-11,23-25,28-30H,4-7,9,12-19H2,1-3H3;3-4H2,1-2H3/b20-8-,21-10+;/t23?,24-,25+,26?;/m1./s1 |
| InChIKey | NAKZUEPSXOGCRG-NACPHDCRSA-N |
| XLogP | 6.99 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|