C9H11NOS — CID 143287189
N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)formamide (PubChem CID 143287189) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)formamide.
| Compound Name | N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)formamide |
|---|---|
| PubChem CID | 143287189 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)formamide |
| SMILES | O=CNc1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C9H11NOS/c11-6-10-9-5-7-3-1-2-4-8(7)12-9/h5-6H,1-4H2,(H,10,11) |
| InChIKey | NPHUDAARZDTOCB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|