C10H11NO4S — CID 143287223
ethyl 2-acetamido-5-formylthiophene-3-carboxylate (PubChem CID 143287223) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is ethyl 2-acetamido-5-formylthiophene-3-carboxylate.
| Compound Name | ethyl 2-acetamido-5-formylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 143287223 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | ethyl 2-acetamido-5-formylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C=O)sc1NC(C)=O |
| InChI | InChI=1S/C10H11NO4S/c1-3-15-10(14)8-4-7(5-12)16-9(8)11-6(2)13/h4-5H,3H2,1-2H3,(H,11,13) |
| InChIKey | BOSZRWSNHQDMMP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|