About ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide
ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide (PubChem CID 143287655) has the molecular formula C14H31N3OS
and a molecular weight of 289.49 g/mol. Its IUPAC name is ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide.
Molecular Properties
| Compound Name | ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide |
| PubChem CID | 143287655 |
| Molecular Formula | C14H31N3OS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide |
| SMILES | C=C(C)NC(=O)CCN1CCN(C)CC1.CC.CS |
| InChI | InChI=1S/C11H21N3O.C2H6.CH4S/c1-10(2)12-11(15)4-5-14-8-6-13(3)7-9-14;2*1-2/h1,4-9H2,2-3H3,(H,12,15);1-2H3;2H,1H3 |
| InChIKey | UGBNESWLVSMLGK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide?
The IUPAC name of ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide (CID 143287655) is ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide.
What is the SMILES notation for ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide?
The canonical SMILES for ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide is C=C(C)NC(=O)CCN1CCN(C)CC1.CC.CS.
What is the InChIKey of ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide?
The InChIKey is UGBNESWLVSMLGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O.C2H6.CH4S/c1-10(2)12-11(15)4-5-14-8-6-13(3)7-9-14;2*1-2/h1,4-9H2,2-3H3,(H,12,15);1-2H3;2H,1H3.
What are the key properties of ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide?
ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide has a molecular weight of 289.49 g/mol, XLogP of 1.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanethiol;3-(4-methylpiperazin-1-yl)-N-prop-1-en-2-ylpropanamide is sourced from PubChem (CID 143287655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).