C27H41N — CID 143287973
1-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine;ethane (PubChem CID 143287973) has the molecular formula C27H41N and a molecular weight of 379.63 g/mol. Its IUPAC name is 1-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine;ethane.
| Compound Name | 1-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 143287973 |
| Molecular Formula | C27H41N |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | 1-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine;ethane |
| SMILES | C=C/C(=N\C=C/C)C1=CCC2C3CC=C4CCCCC4(C)C3CCC12C.CC |
| InChI | InChI=1S/C25H35N.C2H6/c1-5-17-26-23(6-2)22-13-12-20-19-11-10-18-9-7-8-15-24(18,3)21(19)14-16-25(20,22)4;1-2/h5-6,10,13,17,19-21H,2,7-9,11-12,14-16H2,1,3-4H3;1-2H3/b17-5-,26-23+; |
| InChIKey | VLGSSLPNVJWJNF-YBGYVMRMSA-N |
| XLogP | 8.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|