C24H36N2 — CID 143287982
acetylene;N-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N,N'-dimethylmethanimidamide (PubChem CID 143287982) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is acetylene;N-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N,N'-dimethylmethanimidamide.
| Compound Name | acetylene;N-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 143287982 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | acetylene;N-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N,N'-dimethylmethanimidamide |
| SMILES | C#C.C/N=C/N(C)C1=CCC2C3CC=C4CCCCC4(C)C3CCC12C |
| InChI | InChI=1S/C22H34N2.C2H2/c1-21-13-6-5-7-16(21)8-9-17-18-10-11-20(24(4)15-23-3)22(18,2)14-12-19(17)21;1-2/h8,11,15,17-19H,5-7,9-10,12-14H2,1-4H3;1-2H/b23-15+; |
| InChIKey | QZNQNFKCDHFMGG-BUGNPGDCSA-N |
| XLogP | 5.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|