C22H34N2 — CID 143287983
N-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N,N'-dimethylmethanimidamide (PubChem CID 143287983) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is N-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N,N'-dimethylmethanimidamide.
| Compound Name | N-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 143287983 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | N-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-N,N'-dimethylmethanimidamide |
| SMILES | C/N=C/N(C)C1=CCC2C3CC=C4CCCCC4(C)C3CCC12C |
| InChI | InChI=1S/C22H34N2/c1-21-13-6-5-7-16(21)8-9-17-18-10-11-20(24(4)15-23-3)22(18,2)14-12-19(17)21/h8,11,15,17-19H,5-7,9-10,12-14H2,1-4H3/b23-15+ |
| InChIKey | DOLUOCMOOGHGID-HZHRSRAPSA-N |
| XLogP | 5.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|