C15H15N3OS — CID 143288299
N-[4-[[4-(methylideneamino)-3-pyridinyl]sulfanylmethyl]cyclohepta-1,4,6-trien-1-yl]formamide (PubChem CID 143288299) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is N-[4-[[4-(methylideneamino)-3-pyridinyl]sulfanylmethyl]cyclohepta-1,4,6-trien-1-yl]formamide.
| Compound Name | N-[4-[[4-(methylideneamino)-3-pyridinyl]sulfanylmethyl]cyclohepta-1,4,6-trien-1-yl]formamide |
|---|---|
| PubChem CID | 143288299 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[4-[[4-(methylideneamino)-3-pyridinyl]sulfanylmethyl]cyclohepta-1,4,6-trien-1-yl]formamide |
| SMILES | C=Nc1ccncc1SCC1=CC=CC(NC=O)=CC1 |
| InChI | InChI=1S/C15H15N3OS/c1-16-14-7-8-17-9-15(14)20-10-12-3-2-4-13(6-5-12)18-11-19/h2-4,6-9,11H,1,5,10H2,(H,18,19) |
| InChIKey | SJBJKIYLMZHAFW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|