About 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol
4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol (PubChem CID 143288363) has the molecular formula C22H20N2O3
and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol |
| PubChem CID | 143288363 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol |
| SMILES | COc1cc(NCc2c3ccccc3nc3ccccc23)cc(OC)c1O |
| InChI | InChI=1S/C22H20N2O3/c1-26-20-11-14(12-21(27-2)22(20)25)23-13-17-15-7-3-5-9-18(15)24-19-10-6-4-8-16(17)19/h3-12,23,25H,13H2,1-2H3 |
| InChIKey | JZZYDMPJERJGEW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol?
The IUPAC name of 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol (CID 143288363) is 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol.
What is the SMILES notation for 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol?
The canonical SMILES for 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol is COc1cc(NCc2c3ccccc3nc3ccccc23)cc(OC)c1O.
What is the InChIKey of 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol?
The InChIKey is JZZYDMPJERJGEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O3/c1-26-20-11-14(12-21(27-2)22(20)25)23-13-17-15-7-3-5-9-18(15)24-19-10-6-4-8-16(17)19/h3-12,23,25H,13H2,1-2H3.
What are the key properties of 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol?
4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol has a molecular weight of 360.41 g/mol, XLogP of 4.72, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(acridin-9-ylmethylamino)-2,6-dimethoxyphenol is sourced from PubChem (CID 143288363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).