C26H47NO — CID 143288493
2,2,4,4,5-pentamethyl-N-[(5E,7Z)-2,4,4-trimethyl-5-[(Z)-prop-1-enyl]nona-5,7-dien-2-yl]hexanamide (PubChem CID 143288493) has the molecular formula C26H47NO and a molecular weight of 389.67 g/mol. Its IUPAC name is 2,2,4,4,5-pentamethyl-N-[(5E,7Z)-2,4,4-trimethyl-5-[(Z)-prop-1-enyl]nona-5,7-dien-2-yl]hexanamide.
| Compound Name | 2,2,4,4,5-pentamethyl-N-[(5E,7Z)-2,4,4-trimethyl-5-[(Z)-prop-1-enyl]nona-5,7-dien-2-yl]hexanamide |
|---|---|
| PubChem CID | 143288493 |
| Molecular Formula | C26H47NO |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 389.37 |
| IUPAC Name | 2,2,4,4,5-pentamethyl-N-[(5E,7Z)-2,4,4-trimethyl-5-[(Z)-prop-1-enyl]nona-5,7-dien-2-yl]hexanamide |
| SMILES | C/C=C\C=C(/C=C\C)C(C)(C)CC(C)(C)NC(=O)C(C)(C)CC(C)(C)C(C)C |
| InChI | InChI=1S/C26H47NO/c1-13-15-17-21(16-14-2)24(7,8)19-26(11,12)27-22(28)25(9,10)18-23(5,6)20(3)4/h13-17,20H,18-19H2,1-12H3,(H,27,28)/b15-13-,16-14-,21-17+ |
| InChIKey | IVQQFKPOTXNLNP-UMLQNIGXSA-N |
| XLogP | 7.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|