About 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one
2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one (PubChem CID 143288514) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one |
| PubChem CID | 143288514 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one |
| SMILES | C=C(C)CC(C)C.O=C1CCCCC1CO |
| InChI | InChI=1S/C7H12O2.C7H14/c8-5-6-3-1-2-4-7(6)9;1-6(2)5-7(3)4/h6,8H,1-5H2;7H,1,5H2,2-4H3 |
| InChIKey | JOJXUUVQPVSBGN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one?
The IUPAC name of 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one (CID 143288514) is 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one.
What is the SMILES notation for 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one?
The canonical SMILES for 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one is C=C(C)CC(C)C.O=C1CCCCC1CO.
What is the InChIKey of 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one?
The InChIKey is JOJXUUVQPVSBGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C7H14/c8-5-6-3-1-2-4-7(6)9;1-6(2)5-7(3)4/h6,8H,1-5H2;7H,1,5H2,2-4H3.
What are the key properties of 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one?
2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one has a molecular weight of 226.36 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one is sourced from PubChem (CID 143288514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).