C14H26O2 — CID 143288514
2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one (PubChem CID 143288514) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one.
| Compound Name | 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 143288514 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2,4-dimethylpent-1-ene;2-(hydroxymethyl)cyclohexan-1-one |
| SMILES | C=C(C)CC(C)C.O=C1CCCCC1CO |
| InChI | InChI=1S/C7H12O2.C7H14/c8-5-6-3-1-2-4-7(6)9;1-6(2)5-7(3)4/h6,8H,1-5H2;7H,1,5H2,2-4H3 |
| InChIKey | JOJXUUVQPVSBGN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|